C17H23NO — CID 10729862
5-undeca-1,3-diynyl-1,2,3,4-tetrahydroazepin-7-one (PubChem CID 10729862) has the molecular formula C17H23NO and a molecular weight of 257.38 g/mol. Its IUPAC name is 5-undeca-1,3-diynyl-1,2,3,4-tetrahydroazepin-7-one.
| Compound Name | 5-undeca-1,3-diynyl-1,2,3,4-tetrahydroazepin-7-one |
|---|---|
| PubChem CID | 10729862 |
| Molecular Formula | C17H23NO |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.18 |
| IUPAC Name | 5-undeca-1,3-diynyl-1,2,3,4-tetrahydroazepin-7-one |
| SMILES | CCCCCCCC#CC#CC1=CC(=O)NCCC1 |
| InChI | InChI=1S/C17H23NO/c1-2-3-4-5-6-7-8-9-10-12-16-13-11-14-18-17(19)15-16/h15H,2-7,11,13-14H2,1H3,(H,18,19) |
| InChIKey | OBLFKWWWBVRLNJ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|