About 4-ethylphenoxathiine 10,10-dioxide
4-ethylphenoxathiine 10,10-dioxide (PubChem CID 10730054) has the molecular formula C14H12O3S
and a molecular weight of 260.31 g/mol. Its IUPAC name is 4-ethylphenoxathiine 10,10-dioxide.
Molecular Properties
| Compound Name | 4-ethylphenoxathiine 10,10-dioxide |
| PubChem CID | 10730054 |
| Molecular Formula | C14H12O3S |
| Molecular Weight | 260.31 g/mol |
| Exact Mass | 260.05 |
| IUPAC Name | 4-ethylphenoxathiine 10,10-dioxide |
| SMILES | CCc1cccc2c1Oc1ccccc1S2(=O)=O |
| InChI | InChI=1S/C14H12O3S/c1-2-10-6-5-9-13-14(10)17-11-7-3-4-8-12(11)18(13,15)16/h3-9H,2H2,1H3 |
| InChIKey | MMWMTLVWCSLRFP-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.31 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-ethylphenoxathiine 10,10-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethylphenoxathiine 10,10-dioxide?
The IUPAC name of 4-ethylphenoxathiine 10,10-dioxide (CID 10730054) is 4-ethylphenoxathiine 10,10-dioxide.
What is the SMILES notation for 4-ethylphenoxathiine 10,10-dioxide?
The canonical SMILES for 4-ethylphenoxathiine 10,10-dioxide is CCc1cccc2c1Oc1ccccc1S2(=O)=O.
What is the InChIKey of 4-ethylphenoxathiine 10,10-dioxide?
The InChIKey is MMWMTLVWCSLRFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12O3S/c1-2-10-6-5-9-13-14(10)17-11-7-3-4-8-12(11)18(13,15)16/h3-9H,2H2,1H3.
What are the key properties of 4-ethylphenoxathiine 10,10-dioxide?
4-ethylphenoxathiine 10,10-dioxide has a molecular weight of 260.31 g/mol, XLogP of 3.19, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethylphenoxathiine 10,10-dioxide is sourced from PubChem (CID 10730054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).