C13H17BrN2OS — CID 107300795
(6-bromo-3-pyridinyl)-(7,7-dimethyl-1,4-thiazepan-4-yl)methanone (PubChem CID 107300795) has the molecular formula C13H17BrN2OS and a molecular weight of 329.26 g/mol. Its IUPAC name is (6-bromo-3-pyridinyl)-(7,7-dimethyl-1,4-thiazepan-4-yl)methanone.
| Compound Name | (6-bromo-3-pyridinyl)-(7,7-dimethyl-1,4-thiazepan-4-yl)methanone |
|---|---|
| PubChem CID | 107300795 |
| Molecular Formula | C13H17BrN2OS |
| Molecular Weight | 329.26 g/mol |
| Exact Mass | 328.02 |
| IUPAC Name | (6-bromo-3-pyridinyl)-(7,7-dimethyl-1,4-thiazepan-4-yl)methanone |
| SMILES | CC1(C)CCN(C(=O)c2ccc(Br)nc2)CCS1 |
| InChI | InChI=1S/C13H17BrN2OS/c1-13(2)5-6-16(7-8-18-13)12(17)10-3-4-11(14)15-9-10/h3-4,9H,5-8H2,1-2H3 |
| InChIKey | MKYODKJEFIPULI-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.26 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|