C12H24O4Si — CID 10730088
(4R,5R,6R)-6-ethenyl-5-(2-trimethylsilylethoxy)oxane-2,4-diol (PubChem CID 10730088) has the molecular formula C12H24O4Si and a molecular weight of 260.41 g/mol. Its IUPAC name is (4R,5R,6R)-6-ethenyl-5-(2-trimethylsilylethoxy)oxane-2,4-diol.
| Compound Name | (4R,5R,6R)-6-ethenyl-5-(2-trimethylsilylethoxy)oxane-2,4-diol |
|---|---|
| PubChem CID | 10730088 |
| Molecular Formula | C12H24O4Si |
| Molecular Weight | 260.41 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | (4R,5R,6R)-6-ethenyl-5-(2-trimethylsilylethoxy)oxane-2,4-diol |
| SMILES | C=C[C@H]1OC(O)C[C@@H](O)[C@H]1OCC[Si](C)(C)C |
| InChI | InChI=1S/C12H24O4Si/c1-5-10-12(9(13)8-11(14)16-10)15-6-7-17(2,3)4/h5,9-14H,1,6-8H2,2-4H3/t9-,10-,11?,12-/m1/s1 |
| InChIKey | FAKBBIPUHPOHGY-MAPNCKNWSA-N |
| XLogP | 1.36 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.41 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|