C16H22O3 — CID 10730195
[(1R,2S,3R,6S,7R,8S)-6-hydroxy-3-tricyclo[6.2.1.02,7]undeca-4,9-dienyl] 2,2-dimethylpropanoate (PubChem CID 10730195) has the molecular formula C16H22O3 and a molecular weight of 262.35 g/mol. Its IUPAC name is [(1R,2S,3R,6S,7R,8S)-6-hydroxy-3-tricyclo[6.2.1.02,7]undeca-4,9-dienyl] 2,2-dimethylpropanoate.
| Compound Name | [(1R,2S,3R,6S,7R,8S)-6-hydroxy-3-tricyclo[6.2.1.02,7]undeca-4,9-dienyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 10730195 |
| Molecular Formula | C16H22O3 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.16 |
| IUPAC Name | [(1R,2S,3R,6S,7R,8S)-6-hydroxy-3-tricyclo[6.2.1.02,7]undeca-4,9-dienyl] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)O[C@@H]1C=C[C@H](O)[C@H]2[C@@H]1[C@H]1C=C[C@@H]2C1 |
| InChI | InChI=1S/C16H22O3/c1-16(2,3)15(18)19-12-7-6-11(17)13-9-4-5-10(8-9)14(12)13/h4-7,9-14,17H,8H2,1-3H3/t9-,10+,11+,12-,13+,14-/m1/s1 |
| InChIKey | LLYGSSQSUJPRLF-GUDWOMEESA-N |
| XLogP | 2.31 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|