C12H24O6 — CID 10730313
[(2S,3S,5R,6R)-5,6-diethoxy-3-(hydroxymethyl)-5,6-dimethyl-1,4-dioxan-2-yl]methanol (PubChem CID 10730313) has the molecular formula C12H24O6 and a molecular weight of 264.32 g/mol. Its IUPAC name is [(2S,3S,5R,6R)-5,6-diethoxy-3-(hydroxymethyl)-5,6-dimethyl-1,4-dioxan-2-yl]methanol.
| Compound Name | [(2S,3S,5R,6R)-5,6-diethoxy-3-(hydroxymethyl)-5,6-dimethyl-1,4-dioxan-2-yl]methanol |
|---|---|
| PubChem CID | 10730313 |
| Molecular Formula | C12H24O6 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.16 |
| IUPAC Name | [(2S,3S,5R,6R)-5,6-diethoxy-3-(hydroxymethyl)-5,6-dimethyl-1,4-dioxan-2-yl]methanol |
| SMILES | CCO[C@]1(C)O[C@@H](CO)[C@H](CO)O[C@@]1(C)OCC |
| InChI | InChI=1S/C12H24O6/c1-5-15-11(3)12(4,16-6-2)18-10(8-14)9(7-13)17-11/h9-10,13-14H,5-8H2,1-4H3/t9-,10-,11+,12+/m0/s1 |
| InChIKey | PCHSKUZDCJPVLS-NNYUYHANSA-N |
| XLogP | 0.26 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |