C10H9F4NO2 — CID 107303235
3-[2-fluoro-4-(trifluoromethyl)anilino]propanoic acid (PubChem CID 107303235) has the molecular formula C10H9F4NO2 and a molecular weight of 251.18 g/mol. Its IUPAC name is 3-[2-fluoro-4-(trifluoromethyl)anilino]propanoic acid.
| Compound Name | 3-[2-fluoro-4-(trifluoromethyl)anilino]propanoic acid |
|---|---|
| PubChem CID | 107303235 |
| Molecular Formula | C10H9F4NO2 |
| Molecular Weight | 251.18 g/mol |
| Exact Mass | 251.06 |
| IUPAC Name | 3-[2-fluoro-4-(trifluoromethyl)anilino]propanoic acid |
| SMILES | O=C(O)CCNc1ccc(C(F)(F)F)cc1F |
| InChI | InChI=1S/C10H9F4NO2/c11-7-5-6(10(12,13)14)1-2-8(7)15-4-3-9(16)17/h1-2,5,15H,3-4H2,(H,16,17) |
| InChIKey | DTZDJWKZLXHKLN-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.18 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |