C11H12F4OS — CID 107303712
3-[2-fluoro-4-(trifluoromethyl)phenyl]sulfanylbutan-1-ol (PubChem CID 107303712) has the molecular formula C11H12F4OS and a molecular weight of 268.27 g/mol. Its IUPAC name is 3-[2-fluoro-4-(trifluoromethyl)phenyl]sulfanylbutan-1-ol.
| Compound Name | 3-[2-fluoro-4-(trifluoromethyl)phenyl]sulfanylbutan-1-ol |
|---|---|
| PubChem CID | 107303712 |
| Molecular Formula | C11H12F4OS |
| Molecular Weight | 268.27 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | 3-[2-fluoro-4-(trifluoromethyl)phenyl]sulfanylbutan-1-ol |
| SMILES | CC(CCO)Sc1ccc(C(F)(F)F)cc1F |
| InChI | InChI=1S/C11H12F4OS/c1-7(4-5-16)17-10-3-2-8(6-9(10)12)11(13,14)15/h2-3,6-7,16H,4-5H2,1H3 |
| InChIKey | UIHYVCMPFHAUJV-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.27 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |