C9H12F3N3O2S — CID 107304269
2-[[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]amino]hexanoic acid (PubChem CID 107304269) has the molecular formula C9H12F3N3O2S and a molecular weight of 283.28 g/mol. Its IUPAC name is 2-[[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]amino]hexanoic acid.
| Compound Name | 2-[[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]amino]hexanoic acid |
|---|---|
| PubChem CID | 107304269 |
| Molecular Formula | C9H12F3N3O2S |
| Molecular Weight | 283.28 g/mol |
| Exact Mass | 283.06 |
| IUPAC Name | 2-[[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]amino]hexanoic acid |
| SMILES | CCCCC(Nc1nc(C(F)(F)F)ns1)C(=O)O |
| InChI | InChI=1S/C9H12F3N3O2S/c1-2-3-4-5(6(16)17)13-8-14-7(15-18-8)9(10,11)12/h5H,2-4H2,1H3,(H,16,17)(H,13,14,15) |
| InChIKey | PFEILVRWWIFOPN-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.28 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |