C16H10O4 — CID 10730441
2,3-dihydronaphtho[2,3-h][1,4]benzodioxine-7,12-dione (PubChem CID 10730441) has the molecular formula C16H10O4 and a molecular weight of 266.25 g/mol. Its IUPAC name is 2,3-dihydronaphtho[2,3-h][1,4]benzodioxine-7,12-dione.
| Compound Name | 2,3-dihydronaphtho[2,3-h][1,4]benzodioxine-7,12-dione |
|---|---|
| PubChem CID | 10730441 |
| Molecular Formula | C16H10O4 |
| Molecular Weight | 266.25 g/mol |
| Exact Mass | 266.06 |
| IUPAC Name | 2,3-dihydronaphtho[2,3-h][1,4]benzodioxine-7,12-dione |
| SMILES | O=C1c2ccccc2C(=O)c2c1ccc1c2OCCO1 |
| InChI | InChI=1S/C16H10O4/c17-14-9-3-1-2-4-10(9)15(18)13-11(14)5-6-12-16(13)20-8-7-19-12/h1-6H,7-8H2 |
| InChIKey | JPNRAFKCDBJGRS-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.25 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|