C8H6F3N3O2S — CID 107304425
2-[[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]amino]pent-4-ynoic acid (PubChem CID 107304425) has the molecular formula C8H6F3N3O2S and a molecular weight of 265.22 g/mol. Its IUPAC name is 2-[[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]amino]pent-4-ynoic acid.
| Compound Name | 2-[[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]amino]pent-4-ynoic acid |
|---|---|
| PubChem CID | 107304425 |
| Molecular Formula | C8H6F3N3O2S |
| Molecular Weight | 265.22 g/mol |
| Exact Mass | 265.01 |
| IUPAC Name | 2-[[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]amino]pent-4-ynoic acid |
| SMILES | C#CCC(Nc1nc(C(F)(F)F)ns1)C(=O)O |
| InChI | InChI=1S/C8H6F3N3O2S/c1-2-3-4(5(15)16)12-7-13-6(14-17-7)8(9,10)11/h1,4H,3H2,(H,15,16)(H,12,13,14) |
| InChIKey | ZKBQZTFUCSIJOK-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.22 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|