C12H20F3N5S — CID 107304475
5-[4-[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]piperazin-1-yl]pentan-1-amine (PubChem CID 107304475) has the molecular formula C12H20F3N5S and a molecular weight of 323.39 g/mol. Its IUPAC name is 5-[4-[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]piperazin-1-yl]pentan-1-amine.
| Compound Name | 5-[4-[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]piperazin-1-yl]pentan-1-amine |
|---|---|
| PubChem CID | 107304475 |
| Molecular Formula | C12H20F3N5S |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | 5-[4-[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]piperazin-1-yl]pentan-1-amine |
| SMILES | NCCCCCN1CCN(c2nc(C(F)(F)F)ns2)CC1 |
| InChI | InChI=1S/C12H20F3N5S/c13-12(14,15)10-17-11(21-18-10)20-8-6-19(7-9-20)5-3-1-2-4-16/h1-9,16H2 |
| InChIKey | NKHSEXJXKSLOHT-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|