C9H13F3N4S2 — CID 107304524
3-[ethyl-[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]amino]-2-methylpropanethioamide (PubChem CID 107304524) has the molecular formula C9H13F3N4S2 and a molecular weight of 298.36 g/mol. Its IUPAC name is 3-[ethyl-[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]amino]-2-methylpropanethioamide.
| Compound Name | 3-[ethyl-[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]amino]-2-methylpropanethioamide |
|---|---|
| PubChem CID | 107304524 |
| Molecular Formula | C9H13F3N4S2 |
| Molecular Weight | 298.36 g/mol |
| Exact Mass | 298.05 |
| IUPAC Name | 3-[ethyl-[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]amino]-2-methylpropanethioamide |
| SMILES | CCN(CC(C)C(N)=S)c1nc(C(F)(F)F)ns1 |
| InChI | InChI=1S/C9H13F3N4S2/c1-3-16(4-5(2)6(13)17)8-14-7(15-18-8)9(10,11)12/h5H,3-4H2,1-2H3,(H2,13,17) |
| InChIKey | YEGIVGDDQYRSGL-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.36 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|