C10H15F3N4S2 — CID 107304528
3-[2-methylpropyl-[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]amino]propanethioamide (PubChem CID 107304528) has the molecular formula C10H15F3N4S2 and a molecular weight of 312.39 g/mol. Its IUPAC name is 3-[2-methylpropyl-[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]amino]propanethioamide.
| Compound Name | 3-[2-methylpropyl-[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]amino]propanethioamide |
|---|---|
| PubChem CID | 107304528 |
| Molecular Formula | C10H15F3N4S2 |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.07 |
| IUPAC Name | 3-[2-methylpropyl-[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]amino]propanethioamide |
| SMILES | CC(C)CN(CCC(N)=S)c1nc(C(F)(F)F)ns1 |
| InChI | InChI=1S/C10H15F3N4S2/c1-6(2)5-17(4-3-7(14)18)9-15-8(16-19-9)10(11,12)13/h6H,3-5H2,1-2H3,(H2,14,18) |
| InChIKey | SWQIBPYILHFQKI-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|