C8H11F3N4S2 — CID 107304532
3-[methyl-[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]amino]butanethioamide (PubChem CID 107304532) has the molecular formula C8H11F3N4S2 and a molecular weight of 284.33 g/mol. Its IUPAC name is 3-[methyl-[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]amino]butanethioamide.
| Compound Name | 3-[methyl-[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]amino]butanethioamide |
|---|---|
| PubChem CID | 107304532 |
| Molecular Formula | C8H11F3N4S2 |
| Molecular Weight | 284.33 g/mol |
| Exact Mass | 284.04 |
| IUPAC Name | 3-[methyl-[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]amino]butanethioamide |
| SMILES | CC(CC(N)=S)N(C)c1nc(C(F)(F)F)ns1 |
| InChI | InChI=1S/C8H11F3N4S2/c1-4(3-5(12)16)15(2)7-13-6(14-17-7)8(9,10)11/h4H,3H2,1-2H3,(H2,12,16) |
| InChIKey | JEOAMUJNEZPYOM-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.33 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|