About 5-(3-methylpiperazin-1-yl)-3-(trifluoromethyl)-1,2,4-thiadiazole
5-(3-methylpiperazin-1-yl)-3-(trifluoromethyl)-1,2,4-thiadiazole (PubChem CID 107304580) has the molecular formula C8H11F3N4S
and a molecular weight of 252.26 g/mol. Its IUPAC name is 5-(3-methylpiperazin-1-yl)-3-(trifluoromethyl)-1,2,4-thiadiazole.
Molecular Properties
| Compound Name | 5-(3-methylpiperazin-1-yl)-3-(trifluoromethyl)-1,2,4-thiadiazole |
| PubChem CID | 107304580 |
| Molecular Formula | C8H11F3N4S |
| Molecular Weight | 252.26 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | 5-(3-methylpiperazin-1-yl)-3-(trifluoromethyl)-1,2,4-thiadiazole |
| SMILES | CC1CN(c2nc(C(F)(F)F)ns2)CCN1 |
| InChI | InChI=1S/C8H11F3N4S/c1-5-4-15(3-2-12-5)7-13-6(14-16-7)8(9,10)11/h5,12H,2-4H2,1H3 |
| InChIKey | FOFYSFOHNMUHOD-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.26 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-(3-methylpiperazin-1-yl)-3-(trifluoromethyl)-1,2,4-thiadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3-methylpiperazin-1-yl)-3-(trifluoromethyl)-1,2,4-thiadiazole?
The IUPAC name of 5-(3-methylpiperazin-1-yl)-3-(trifluoromethyl)-1,2,4-thiadiazole (CID 107304580) is 5-(3-methylpiperazin-1-yl)-3-(trifluoromethyl)-1,2,4-thiadiazole.
What is the SMILES notation for 5-(3-methylpiperazin-1-yl)-3-(trifluoromethyl)-1,2,4-thiadiazole?
The canonical SMILES for 5-(3-methylpiperazin-1-yl)-3-(trifluoromethyl)-1,2,4-thiadiazole is CC1CN(c2nc(C(F)(F)F)ns2)CCN1.
What is the InChIKey of 5-(3-methylpiperazin-1-yl)-3-(trifluoromethyl)-1,2,4-thiadiazole?
The InChIKey is FOFYSFOHNMUHOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11F3N4S/c1-5-4-15(3-2-12-5)7-13-6(14-16-7)8(9,10)11/h5,12H,2-4H2,1H3.
What are the key properties of 5-(3-methylpiperazin-1-yl)-3-(trifluoromethyl)-1,2,4-thiadiazole?
5-(3-methylpiperazin-1-yl)-3-(trifluoromethyl)-1,2,4-thiadiazole has a molecular weight of 252.26 g/mol, XLogP of 1.36, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3-methylpiperazin-1-yl)-3-(trifluoromethyl)-1,2,4-thiadiazole is sourced from PubChem (CID 107304580), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).