C9H14F3N5S — CID 107304623
3-[ethyl-[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]amino]-2-methylpropanimidamide (PubChem CID 107304623) has the molecular formula C9H14F3N5S and a molecular weight of 281.31 g/mol. Its IUPAC name is 3-[ethyl-[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]amino]-2-methylpropanimidamide.
| Compound Name | 3-[ethyl-[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]amino]-2-methylpropanimidamide |
|---|---|
| PubChem CID | 107304623 |
| Molecular Formula | C9H14F3N5S |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.09 |
| IUPAC Name | 3-[ethyl-[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]amino]-2-methylpropanimidamide |
| SMILES | [H]/N=C(\N)C(C)CN(CC)c1nc(C(F)(F)F)ns1 |
| InChI | InChI=1S/C9H14F3N5S/c1-3-17(4-5(2)6(13)14)8-15-7(16-18-8)9(10,11)12/h5H,3-4H2,1-2H3,(H3,13,14) |
| InChIKey | PGSNMEXLVSNWOD-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 78.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|