C10H16F3N5S — CID 107304627
3-[2-methylpropyl-[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]amino]propanimidamide (PubChem CID 107304627) has the molecular formula C10H16F3N5S and a molecular weight of 295.33 g/mol. Its IUPAC name is 3-[2-methylpropyl-[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]amino]propanimidamide.
| Compound Name | 3-[2-methylpropyl-[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]amino]propanimidamide |
|---|---|
| PubChem CID | 107304627 |
| Molecular Formula | C10H16F3N5S |
| Molecular Weight | 295.33 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | 3-[2-methylpropyl-[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]amino]propanimidamide |
| SMILES | [H]/N=C(\N)CCN(CC(C)C)c1nc(C(F)(F)F)ns1 |
| InChI | InChI=1S/C10H16F3N5S/c1-6(2)5-18(4-3-7(14)15)9-16-8(17-19-9)10(11,12)13/h6H,3-5H2,1-2H3,(H3,14,15) |
| InChIKey | MVPUVMDULDCIGI-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 78.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.33 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|