About 1-[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]piperidine-4-carboximidamide
1-[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]piperidine-4-carboximidamide (PubChem CID 107304633) has the molecular formula C9H12F3N5S
and a molecular weight of 279.29 g/mol. Its IUPAC name is 1-[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]piperidine-4-carboximidamide.
Molecular Properties
| Compound Name | 1-[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]piperidine-4-carboximidamide |
| PubChem CID | 107304633 |
| Molecular Formula | C9H12F3N5S |
| Molecular Weight | 279.29 g/mol |
| Exact Mass | 279.08 |
| IUPAC Name | 1-[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]piperidine-4-carboximidamide |
| SMILES | [H]/N=C(\N)C1CCN(c2nc(C(F)(F)F)ns2)CC1 |
| InChI | InChI=1S/C9H12F3N5S/c10-9(11,12)7-15-8(18-16-7)17-3-1-5(2-4-17)6(13)14/h5H,1-4H2,(H3,13,14) |
| InChIKey | RLMYSTLUZUBTRB-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 78.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.29 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]piperidine-4-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]piperidine-4-carboximidamide?
The IUPAC name of 1-[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]piperidine-4-carboximidamide (CID 107304633) is 1-[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]piperidine-4-carboximidamide.
What is the SMILES notation for 1-[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]piperidine-4-carboximidamide?
The canonical SMILES for 1-[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]piperidine-4-carboximidamide is [H]/N=C(\N)C1CCN(c2nc(C(F)(F)F)ns2)CC1.
What is the InChIKey of 1-[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]piperidine-4-carboximidamide?
The InChIKey is RLMYSTLUZUBTRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12F3N5S/c10-9(11,12)7-15-8(18-16-7)17-3-1-5(2-4-17)6(13)14/h5H,1-4H2,(H3,13,14).
What are the key properties of 1-[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]piperidine-4-carboximidamide?
1-[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]piperidine-4-carboximidamide has a molecular weight of 279.29 g/mol, XLogP of 1.71, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]piperidine-4-carboximidamide is sourced from PubChem (CID 107304633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).