C10H17F3N4S — CID 107304680
N',N'-diethyl-N-[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]propane-1,3-diamine (PubChem CID 107304680) has the molecular formula C10H17F3N4S and a molecular weight of 282.33 g/mol. Its IUPAC name is N',N'-diethyl-N-[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]propane-1,3-diamine.
| Compound Name | N',N'-diethyl-N-[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]propane-1,3-diamine |
|---|---|
| PubChem CID | 107304680 |
| Molecular Formula | C10H17F3N4S |
| Molecular Weight | 282.33 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | N',N'-diethyl-N-[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]propane-1,3-diamine |
| SMILES | CCN(CC)CCCNc1nc(C(F)(F)F)ns1 |
| InChI | InChI=1S/C10H17F3N4S/c1-3-17(4-2)7-5-6-14-9-15-8(16-18-9)10(11,12)13/h3-7H2,1-2H3,(H,14,15,16) |
| InChIKey | CEXBFQXNVRQAEX-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.33 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|