C6H9F3N4O2S2 — CID 107304881
3-[[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]amino]propane-1-sulfonamide (PubChem CID 107304881) has the molecular formula C6H9F3N4O2S2 and a molecular weight of 290.29 g/mol. Its IUPAC name is 3-[[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]amino]propane-1-sulfonamide.
| Compound Name | 3-[[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]amino]propane-1-sulfonamide |
|---|---|
| PubChem CID | 107304881 |
| Molecular Formula | C6H9F3N4O2S2 |
| Molecular Weight | 290.29 g/mol |
| Exact Mass | 290.01 |
| IUPAC Name | 3-[[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]amino]propane-1-sulfonamide |
| SMILES | NS(=O)(=O)CCCNc1nc(C(F)(F)F)ns1 |
| InChI | InChI=1S/C6H9F3N4O2S2/c7-6(8,9)4-12-5(16-13-4)11-2-1-3-17(10,14)15/h1-3H2,(H2,10,14,15)(H,11,12,13) |
| InChIKey | VVYHYIMRJKUDAU-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.29 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|