C8H9F3N6S — CID 107304987
N-[3-(1H-1,2,4-triazol-5-yl)propyl]-3-(trifluoromethyl)-1,2,4-thiadiazol-5-amine (PubChem CID 107304987) has the molecular formula C8H9F3N6S and a molecular weight of 278.26 g/mol. Its IUPAC name is N-[3-(1H-1,2,4-triazol-5-yl)propyl]-3-(trifluoromethyl)-1,2,4-thiadiazol-5-amine.
| Compound Name | N-[3-(1H-1,2,4-triazol-5-yl)propyl]-3-(trifluoromethyl)-1,2,4-thiadiazol-5-amine |
|---|---|
| PubChem CID | 107304987 |
| Molecular Formula | C8H9F3N6S |
| Molecular Weight | 278.26 g/mol |
| Exact Mass | 278.06 |
| IUPAC Name | N-[3-(1H-1,2,4-triazol-5-yl)propyl]-3-(trifluoromethyl)-1,2,4-thiadiazol-5-amine |
| SMILES | FC(F)(F)c1nsc(NCCCc2ncn[nH]2)n1 |
| InChI | InChI=1S/C8H9F3N6S/c9-8(10,11)6-15-7(18-17-6)12-3-1-2-5-13-4-14-16-5/h4H,1-3H2,(H,12,15,17)(H,13,14,16) |
| InChIKey | YYRPZOZECIYTHQ-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.26 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|