C9H10F3N5S — CID 107305119
N-(3-pyrazol-1-ylpropyl)-3-(trifluoromethyl)-1,2,4-thiadiazol-5-amine (PubChem CID 107305119) has the molecular formula C9H10F3N5S and a molecular weight of 277.28 g/mol. Its IUPAC name is N-(3-pyrazol-1-ylpropyl)-3-(trifluoromethyl)-1,2,4-thiadiazol-5-amine.
| Compound Name | N-(3-pyrazol-1-ylpropyl)-3-(trifluoromethyl)-1,2,4-thiadiazol-5-amine |
|---|---|
| PubChem CID | 107305119 |
| Molecular Formula | C9H10F3N5S |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.06 |
| IUPAC Name | N-(3-pyrazol-1-ylpropyl)-3-(trifluoromethyl)-1,2,4-thiadiazol-5-amine |
| SMILES | FC(F)(F)c1nsc(NCCCn2cccn2)n1 |
| InChI | InChI=1S/C9H10F3N5S/c10-9(11,12)7-15-8(18-16-7)13-3-1-5-17-6-2-4-14-17/h2,4,6H,1,3,5H2,(H,13,15,16) |
| InChIKey | UZLKADAWVLBZEJ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|