About 1-[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]pyrrolidin-3-amine
1-[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]pyrrolidin-3-amine (PubChem CID 107305312) has the molecular formula C7H9F3N4S
and a molecular weight of 238.24 g/mol. Its IUPAC name is 1-[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]pyrrolidin-3-amine.
Molecular Properties
| Compound Name | 1-[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]pyrrolidin-3-amine |
| PubChem CID | 107305312 |
| Molecular Formula | C7H9F3N4S |
| Molecular Weight | 238.24 g/mol |
| Exact Mass | 238.05 |
| IUPAC Name | 1-[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]pyrrolidin-3-amine |
| SMILES | NC1CCN(c2nc(C(F)(F)F)ns2)C1 |
| InChI | InChI=1S/C7H9F3N4S/c8-7(9,10)5-12-6(15-13-5)14-2-1-4(11)3-14/h4H,1-3,11H2 |
| InChIKey | OWWMTQRQTQRQPX-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.24 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]pyrrolidin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]pyrrolidin-3-amine?
The IUPAC name of 1-[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]pyrrolidin-3-amine (CID 107305312) is 1-[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]pyrrolidin-3-amine.
What is the SMILES notation for 1-[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]pyrrolidin-3-amine?
The canonical SMILES for 1-[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]pyrrolidin-3-amine is NC1CCN(c2nc(C(F)(F)F)ns2)C1.
What is the InChIKey of 1-[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]pyrrolidin-3-amine?
The InChIKey is OWWMTQRQTQRQPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9F3N4S/c8-7(9,10)5-12-6(15-13-5)14-2-1-4(11)3-14/h4H,1-3,11H2.
What are the key properties of 1-[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]pyrrolidin-3-amine?
1-[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]pyrrolidin-3-amine has a molecular weight of 238.24 g/mol, XLogP of 1.09, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]pyrrolidin-3-amine is sourced from PubChem (CID 107305312), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).