C11H11F3N4OS — CID 107305563
1-(4-aminophenyl)-2-[[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]amino]ethanol (PubChem CID 107305563) has the molecular formula C11H11F3N4OS and a molecular weight of 304.30 g/mol. Its IUPAC name is 1-(4-aminophenyl)-2-[[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]amino]ethanol.
| Compound Name | 1-(4-aminophenyl)-2-[[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]amino]ethanol |
|---|---|
| PubChem CID | 107305563 |
| Molecular Formula | C11H11F3N4OS |
| Molecular Weight | 304.30 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | 1-(4-aminophenyl)-2-[[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]amino]ethanol |
| SMILES | Nc1ccc(C(O)CNc2nc(C(F)(F)F)ns2)cc1 |
| InChI | InChI=1S/C11H11F3N4OS/c12-11(13,14)9-17-10(20-18-9)16-5-8(19)6-1-3-7(15)4-2-6/h1-4,8,19H,5,15H2,(H,16,17,18) |
| InChIKey | UBHNHMHWBIJBCS-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 84.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.30 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|