C13H14ClNO3 — CID 10730576
(2R,7aR)-7a-(4-chlorophenyl)-2-(hydroxymethyl)-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]oxazol-5-one (PubChem CID 10730576) has the molecular formula C13H14ClNO3 and a molecular weight of 267.71 g/mol. Its IUPAC name is (2R,7aR)-7a-(4-chlorophenyl)-2-(hydroxymethyl)-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]oxazol-5-one.
| Compound Name | (2R,7aR)-7a-(4-chlorophenyl)-2-(hydroxymethyl)-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]oxazol-5-one |
|---|---|
| PubChem CID | 10730576 |
| Molecular Formula | C13H14ClNO3 |
| Molecular Weight | 267.71 g/mol |
| Exact Mass | 267.07 |
| IUPAC Name | (2R,7aR)-7a-(4-chlorophenyl)-2-(hydroxymethyl)-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]oxazol-5-one |
| SMILES | O=C1CC[C@]2(c3ccc(Cl)cc3)O[C@@H](CO)CN12 |
| InChI | InChI=1S/C13H14ClNO3/c14-10-3-1-9(2-4-10)13-6-5-12(17)15(13)7-11(8-16)18-13/h1-4,11,16H,5-8H2/t11-,13-/m1/s1 |
| InChIKey | AWBXGIBCUPSNSP-DGCLKSJQSA-N |
| XLogP | 1.51 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.71 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |