About 1-[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]pyrazol-4-amine
1-[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]pyrazol-4-amine (PubChem CID 107305760) has the molecular formula C6H4F3N5S
and a molecular weight of 235.19 g/mol. Its IUPAC name is 1-[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]pyrazol-4-amine.
Molecular Properties
| Compound Name | 1-[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]pyrazol-4-amine |
| PubChem CID | 107305760 |
| Molecular Formula | C6H4F3N5S |
| Molecular Weight | 235.19 g/mol |
| Exact Mass | 235.01 |
| IUPAC Name | 1-[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]pyrazol-4-amine |
| SMILES | Nc1cnn(-c2nc(C(F)(F)F)ns2)c1 |
| InChI | InChI=1S/C6H4F3N5S/c7-6(8,9)4-12-5(15-13-4)14-2-3(10)1-11-14/h1-2H,10H2 |
| InChIKey | SIJAXZMSSQWZPM-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.19 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]pyrazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]pyrazol-4-amine?
The IUPAC name of 1-[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]pyrazol-4-amine (CID 107305760) is 1-[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]pyrazol-4-amine.
What is the SMILES notation for 1-[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]pyrazol-4-amine?
The canonical SMILES for 1-[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]pyrazol-4-amine is Nc1cnn(-c2nc(C(F)(F)F)ns2)c1.
What is the InChIKey of 1-[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]pyrazol-4-amine?
The InChIKey is SIJAXZMSSQWZPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4F3N5S/c7-6(8,9)4-12-5(15-13-4)14-2-3(10)1-11-14/h1-2H,10H2.
What are the key properties of 1-[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]pyrazol-4-amine?
1-[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]pyrazol-4-amine has a molecular weight of 235.19 g/mol, XLogP of 1.32, 1 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]pyrazol-4-amine is sourced from PubChem (CID 107305760), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).