C16H17Cl2NO — CID 107305773
1-[4-[(2,3-dichlorophenyl)methoxy]phenyl]-N-methylethanamine (PubChem CID 107305773) has the molecular formula C16H17Cl2NO and a molecular weight of 310.22 g/mol. Its IUPAC name is 1-[4-[(2,3-dichlorophenyl)methoxy]phenyl]-N-methylethanamine.
| Compound Name | 1-[4-[(2,3-dichlorophenyl)methoxy]phenyl]-N-methylethanamine |
|---|---|
| PubChem CID | 107305773 |
| Molecular Formula | C16H17Cl2NO |
| Molecular Weight | 310.22 g/mol |
| Exact Mass | 309.07 |
| IUPAC Name | 1-[4-[(2,3-dichlorophenyl)methoxy]phenyl]-N-methylethanamine |
| SMILES | CNC(C)c1ccc(OCc2cccc(Cl)c2Cl)cc1 |
| InChI | InChI=1S/C16H17Cl2NO/c1-11(19-2)12-6-8-14(9-7-12)20-10-13-4-3-5-15(17)16(13)18/h3-9,11,19H,10H2,1-2H3 |
| InChIKey | RLYCOXADTILFSW-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.22 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |