C6H7BrF3N3S — CID 107306121
N-(2-bromoethyl)-N-methyl-3-(trifluoromethyl)-1,2,4-thiadiazol-5-amine (PubChem CID 107306121) has the molecular formula C6H7BrF3N3S and a molecular weight of 290.11 g/mol. Its IUPAC name is N-(2-bromoethyl)-N-methyl-3-(trifluoromethyl)-1,2,4-thiadiazol-5-amine.
| Compound Name | N-(2-bromoethyl)-N-methyl-3-(trifluoromethyl)-1,2,4-thiadiazol-5-amine |
|---|---|
| PubChem CID | 107306121 |
| Molecular Formula | C6H7BrF3N3S |
| Molecular Weight | 290.11 g/mol |
| Exact Mass | 288.95 |
| IUPAC Name | N-(2-bromoethyl)-N-methyl-3-(trifluoromethyl)-1,2,4-thiadiazol-5-amine |
| SMILES | CN(CCBr)c1nc(C(F)(F)F)ns1 |
| InChI | InChI=1S/C6H7BrF3N3S/c1-13(3-2-7)5-11-4(12-14-5)6(8,9)10/h2-3H2,1H3 |
| InChIKey | FYXGPMCNYPDTAO-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.11 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|