About N-(3-chloro-2-methylbutan-2-yl)-3-(trifluoromethyl)-1,2,4-thiadiazol-5-amine
N-(3-chloro-2-methylbutan-2-yl)-3-(trifluoromethyl)-1,2,4-thiadiazol-5-amine (PubChem CID 107306182) has the molecular formula C8H11ClF3N3S
and a molecular weight of 273.71 g/mol. Its IUPAC name is N-(3-chloro-2-methylbutan-2-yl)-3-(trifluoromethyl)-1,2,4-thiadiazol-5-amine.
Molecular Properties
| Compound Name | N-(3-chloro-2-methylbutan-2-yl)-3-(trifluoromethyl)-1,2,4-thiadiazol-5-amine |
| PubChem CID | 107306182 |
| Molecular Formula | C8H11ClF3N3S |
| Molecular Weight | 273.71 g/mol |
| Exact Mass | 273.03 |
| IUPAC Name | N-(3-chloro-2-methylbutan-2-yl)-3-(trifluoromethyl)-1,2,4-thiadiazol-5-amine |
| SMILES | CC(Cl)C(C)(C)Nc1nc(C(F)(F)F)ns1 |
| InChI | InChI=1S/C8H11ClF3N3S/c1-4(9)7(2,3)14-6-13-5(15-16-6)8(10,11)12/h4H,1-3H3,(H,13,14,15) |
| InChIKey | RIUJRYFKXLIIPT-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.71 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze N-(3-chloro-2-methylbutan-2-yl)-3-(trifluoromethyl)-1,2,4-thiadiazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-chloro-2-methylbutan-2-yl)-3-(trifluoromethyl)-1,2,4-thiadiazol-5-amine?
The IUPAC name of N-(3-chloro-2-methylbutan-2-yl)-3-(trifluoromethyl)-1,2,4-thiadiazol-5-amine (CID 107306182) is N-(3-chloro-2-methylbutan-2-yl)-3-(trifluoromethyl)-1,2,4-thiadiazol-5-amine.
What is the SMILES notation for N-(3-chloro-2-methylbutan-2-yl)-3-(trifluoromethyl)-1,2,4-thiadiazol-5-amine?
The canonical SMILES for N-(3-chloro-2-methylbutan-2-yl)-3-(trifluoromethyl)-1,2,4-thiadiazol-5-amine is CC(Cl)C(C)(C)Nc1nc(C(F)(F)F)ns1.
What is the InChIKey of N-(3-chloro-2-methylbutan-2-yl)-3-(trifluoromethyl)-1,2,4-thiadiazol-5-amine?
The InChIKey is RIUJRYFKXLIIPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11ClF3N3S/c1-4(9)7(2,3)14-6-13-5(15-16-6)8(10,11)12/h4H,1-3H3,(H,13,14,15).
What are the key properties of N-(3-chloro-2-methylbutan-2-yl)-3-(trifluoromethyl)-1,2,4-thiadiazol-5-amine?
N-(3-chloro-2-methylbutan-2-yl)-3-(trifluoromethyl)-1,2,4-thiadiazol-5-amine has a molecular weight of 273.71 g/mol, XLogP of 3.37, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-chloro-2-methylbutan-2-yl)-3-(trifluoromethyl)-1,2,4-thiadiazol-5-amine is sourced from PubChem (CID 107306182), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).