C14H11Cl2NO4 — CID 107306792
[2-[(2,3-dichlorophenyl)methoxy]-5-nitrophenyl]methanol (PubChem CID 107306792) has the molecular formula C14H11Cl2NO4 and a molecular weight of 328.15 g/mol. Its IUPAC name is [2-[(2,3-dichlorophenyl)methoxy]-5-nitrophenyl]methanol.
| Compound Name | [2-[(2,3-dichlorophenyl)methoxy]-5-nitrophenyl]methanol |
|---|---|
| PubChem CID | 107306792 |
| Molecular Formula | C14H11Cl2NO4 |
| Molecular Weight | 328.15 g/mol |
| Exact Mass | 327.01 |
| IUPAC Name | [2-[(2,3-dichlorophenyl)methoxy]-5-nitrophenyl]methanol |
| SMILES | O=[N+]([O-])c1ccc(OCc2cccc(Cl)c2Cl)c(CO)c1 |
| InChI | InChI=1S/C14H11Cl2NO4/c15-12-3-1-2-9(14(12)16)8-21-13-5-4-11(17(19)20)6-10(13)7-18/h1-6,18H,7-8H2 |
| InChIKey | FNEOCBITIRQFER-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 72.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.15 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|