C16H15BrCl2O2 — CID 107306903
1-[[4-(bromomethyl)-2-ethoxyphenoxy]methyl]-2,3-dichlorobenzene (PubChem CID 107306903) has the molecular formula C16H15BrCl2O2 and a molecular weight of 390.10 g/mol. Its IUPAC name is 1-[[4-(bromomethyl)-2-ethoxyphenoxy]methyl]-2,3-dichlorobenzene.
| Compound Name | 1-[[4-(bromomethyl)-2-ethoxyphenoxy]methyl]-2,3-dichlorobenzene |
|---|---|
| PubChem CID | 107306903 |
| Molecular Formula | C16H15BrCl2O2 |
| Molecular Weight | 390.10 g/mol |
| Exact Mass | 387.96 |
| IUPAC Name | 1-[[4-(bromomethyl)-2-ethoxyphenoxy]methyl]-2,3-dichlorobenzene |
| SMILES | CCOc1cc(CBr)ccc1OCc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C16H15BrCl2O2/c1-2-20-15-8-11(9-17)6-7-14(15)21-10-12-4-3-5-13(18)16(12)19/h3-8H,2,9-10H2,1H3 |
| InChIKey | UHJWJOHAKLOKFY-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.10 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|