C14H22O5 — CID 10730743
5-[(E)-2-(methoxymethoxy)pent-3-enyl]-2,2,6-trimethyl-1,3-dioxin-4-one (PubChem CID 10730743) has the molecular formula C14H22O5 and a molecular weight of 270.32 g/mol. Its IUPAC name is 5-[(E)-2-(methoxymethoxy)pent-3-enyl]-2,2,6-trimethyl-1,3-dioxin-4-one.
| Compound Name | 5-[(E)-2-(methoxymethoxy)pent-3-enyl]-2,2,6-trimethyl-1,3-dioxin-4-one |
|---|---|
| PubChem CID | 10730743 |
| Molecular Formula | C14H22O5 |
| Molecular Weight | 270.32 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | 5-[(E)-2-(methoxymethoxy)pent-3-enyl]-2,2,6-trimethyl-1,3-dioxin-4-one |
| SMILES | C/C=C/C(CC1=C(C)OC(C)(C)OC1=O)OCOC |
| InChI | InChI=1S/C14H22O5/c1-6-7-11(17-9-16-5)8-12-10(2)18-14(3,4)19-13(12)15/h6-7,11H,8-9H2,1-5H3/b7-6+ |
| InChIKey | RGSMUBMNINCYPL-VOTSOKGWSA-N |
| XLogP | 2.53 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.32 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|