C15H11BrCl2OS — CID 107307922
1-(4-bromophenyl)sulfanyl-3-(2,3-dichlorophenyl)propan-2-one (PubChem CID 107307922) has the molecular formula C15H11BrCl2OS and a molecular weight of 390.13 g/mol. Its IUPAC name is 1-(4-bromophenyl)sulfanyl-3-(2,3-dichlorophenyl)propan-2-one.
| Compound Name | 1-(4-bromophenyl)sulfanyl-3-(2,3-dichlorophenyl)propan-2-one |
|---|---|
| PubChem CID | 107307922 |
| Molecular Formula | C15H11BrCl2OS |
| Molecular Weight | 390.13 g/mol |
| Exact Mass | 387.91 |
| IUPAC Name | 1-(4-bromophenyl)sulfanyl-3-(2,3-dichlorophenyl)propan-2-one |
| SMILES | O=C(CSc1ccc(Br)cc1)Cc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C15H11BrCl2OS/c16-11-4-6-13(7-5-11)20-9-12(19)8-10-2-1-3-14(17)15(10)18/h1-7H,8-9H2 |
| InChIKey | TXWMRAWKZMTCFO-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.13 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |