C18H27Cl2N — CID 107308723
2-(2,3-dichlorophenyl)-N-ethyl-1-(3-ethylcyclohexyl)ethanamine (PubChem CID 107308723) has the molecular formula C18H27Cl2N and a molecular weight of 328.33 g/mol. Its IUPAC name is 2-(2,3-dichlorophenyl)-N-ethyl-1-(3-ethylcyclohexyl)ethanamine.
| Compound Name | 2-(2,3-dichlorophenyl)-N-ethyl-1-(3-ethylcyclohexyl)ethanamine |
|---|---|
| PubChem CID | 107308723 |
| Molecular Formula | C18H27Cl2N |
| Molecular Weight | 328.33 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | 2-(2,3-dichlorophenyl)-N-ethyl-1-(3-ethylcyclohexyl)ethanamine |
| SMILES | CCNC(Cc1cccc(Cl)c1Cl)C1CCCC(CC)C1 |
| InChI | InChI=1S/C18H27Cl2N/c1-3-13-7-5-8-14(11-13)17(21-4-2)12-15-9-6-10-16(19)18(15)20/h6,9-10,13-14,17,21H,3-5,7-8,11-12H2,1-2H3 |
| InChIKey | NVGJJUCIBNBWTI-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.33 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |