About [(2E)-2-[(4S,6R)-4-(3-hydroxybutyl)-6-methoxyoxan-3-ylidene]ethyl] acetate
[(2E)-2-[(4S,6R)-4-(3-hydroxybutyl)-6-methoxyoxan-3-ylidene]ethyl] acetate (PubChem CID 10730897) has the molecular formula C14H24O5
and a molecular weight of 272.34 g/mol. Its IUPAC name is [(2E)-2-[(4S,6R)-4-(3-hydroxybutyl)-6-methoxyoxan-3-ylidene]ethyl] acetate.
Molecular Properties
| Compound Name | [(2E)-2-[(4S,6R)-4-(3-hydroxybutyl)-6-methoxyoxan-3-ylidene]ethyl] acetate |
| PubChem CID | 10730897 |
| Molecular Formula | C14H24O5 |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | [(2E)-2-[(4S,6R)-4-(3-hydroxybutyl)-6-methoxyoxan-3-ylidene]ethyl] acetate |
| SMILES | CO[C@H]1C[C@H](CCC(C)O)/C(=C\COC(C)=O)CO1 |
| InChI | InChI=1S/C14H24O5/c1-10(15)4-5-12-8-14(17-3)19-9-13(12)6-7-18-11(2)16/h6,10,12,14-15H,4-5,7-9H2,1-3H3/b13-6-/t10?,12-,14+/m0/s1 |
| InChIKey | CKHCHVBCBZEMJI-FBBFYYQXSA-N |
| XLogP | 1.65 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(2E)-2-[(4S,6R)-4-(3-hydroxybutyl)-6-methoxyoxan-3-ylidene]ethyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2E)-2-[(4S,6R)-4-(3-hydroxybutyl)-6-methoxyoxan-3-ylidene]ethyl] acetate?
The IUPAC name of [(2E)-2-[(4S,6R)-4-(3-hydroxybutyl)-6-methoxyoxan-3-ylidene]ethyl] acetate (CID 10730897) is [(2E)-2-[(4S,6R)-4-(3-hydroxybutyl)-6-methoxyoxan-3-ylidene]ethyl] acetate.
What is the SMILES notation for [(2E)-2-[(4S,6R)-4-(3-hydroxybutyl)-6-methoxyoxan-3-ylidene]ethyl] acetate?
The canonical SMILES for [(2E)-2-[(4S,6R)-4-(3-hydroxybutyl)-6-methoxyoxan-3-ylidene]ethyl] acetate is CO[C@H]1C[C@H](CCC(C)O)/C(=C\COC(C)=O)CO1.
What is the InChIKey of [(2E)-2-[(4S,6R)-4-(3-hydroxybutyl)-6-methoxyoxan-3-ylidene]ethyl] acetate?
The InChIKey is CKHCHVBCBZEMJI-FBBFYYQXSA-N. The full InChI is InChI=1S/C14H24O5/c1-10(15)4-5-12-8-14(17-3)19-9-13(12)6-7-18-11(2)16/h6,10,12,14-15H,4-5,7-9H2,1-3H3/b13-6-/t10?,12-,14+/m0/s1.
What are the key properties of [(2E)-2-[(4S,6R)-4-(3-hydroxybutyl)-6-methoxyoxan-3-ylidene]ethyl] acetate?
[(2E)-2-[(4S,6R)-4-(3-hydroxybutyl)-6-methoxyoxan-3-ylidene]ethyl] acetate has a molecular weight of 272.34 g/mol, XLogP of 1.65, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(2E)-2-[(4S,6R)-4-(3-hydroxybutyl)-6-methoxyoxan-3-ylidene]ethyl] acetate is sourced from PubChem (CID 10730897), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).