C17H18BrCl2N — CID 107309793
2-(2-bromophenyl)-3-(2,3-dichlorophenyl)-N-ethylpropan-1-amine (PubChem CID 107309793) has the molecular formula C17H18BrCl2N and a molecular weight of 387.15 g/mol. Its IUPAC name is 2-(2-bromophenyl)-3-(2,3-dichlorophenyl)-N-ethylpropan-1-amine.
| Compound Name | 2-(2-bromophenyl)-3-(2,3-dichlorophenyl)-N-ethylpropan-1-amine |
|---|---|
| PubChem CID | 107309793 |
| Molecular Formula | C17H18BrCl2N |
| Molecular Weight | 387.15 g/mol |
| Exact Mass | 385.00 |
| IUPAC Name | 2-(2-bromophenyl)-3-(2,3-dichlorophenyl)-N-ethylpropan-1-amine |
| SMILES | CCNCC(Cc1cccc(Cl)c1Cl)c1ccccc1Br |
| InChI | InChI=1S/C17H18BrCl2N/c1-2-21-11-13(14-7-3-4-8-15(14)18)10-12-6-5-9-16(19)17(12)20/h3-9,13,21H,2,10-11H2,1H3 |
| InChIKey | FACCDGUBTMDBNK-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.15 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |