C15H22Cl2N2 — CID 107310541
1-[(2,3-dichlorophenyl)methyl]-3,3,7-trimethyl-1,4-diazepane (PubChem CID 107310541) has the molecular formula C15H22Cl2N2 and a molecular weight of 301.26 g/mol. Its IUPAC name is 1-[(2,3-dichlorophenyl)methyl]-3,3,7-trimethyl-1,4-diazepane.
| Compound Name | 1-[(2,3-dichlorophenyl)methyl]-3,3,7-trimethyl-1,4-diazepane |
|---|---|
| PubChem CID | 107310541 |
| Molecular Formula | C15H22Cl2N2 |
| Molecular Weight | 301.26 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | 1-[(2,3-dichlorophenyl)methyl]-3,3,7-trimethyl-1,4-diazepane |
| SMILES | CC1CCNC(C)(C)CN1Cc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C15H22Cl2N2/c1-11-7-8-18-15(2,3)10-19(11)9-12-5-4-6-13(16)14(12)17/h4-6,11,18H,7-10H2,1-3H3 |
| InChIKey | XGLKGVHBTHSBRS-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.26 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |