C15H12BrCl3 — CID 107310833
1-[3-bromo-2-(3-chlorophenyl)propyl]-2,3-dichlorobenzene (PubChem CID 107310833) has the molecular formula C15H12BrCl3 and a molecular weight of 378.52 g/mol. Its IUPAC name is 1-[3-bromo-2-(3-chlorophenyl)propyl]-2,3-dichlorobenzene.
| Compound Name | 1-[3-bromo-2-(3-chlorophenyl)propyl]-2,3-dichlorobenzene |
|---|---|
| PubChem CID | 107310833 |
| Molecular Formula | C15H12BrCl3 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 375.92 |
| IUPAC Name | 1-[3-bromo-2-(3-chlorophenyl)propyl]-2,3-dichlorobenzene |
| SMILES | Clc1cccc(C(CBr)Cc2cccc(Cl)c2Cl)c1 |
| InChI | InChI=1S/C15H12BrCl3/c16-9-12(10-3-1-5-13(17)8-10)7-11-4-2-6-14(18)15(11)19/h1-6,8,12H,7,9H2 |
| InChIKey | RVLKWQYWMDMPDJ-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|