C15H10Cl2IN3 — CID 107310995
1-[(2,3-dichlorophenyl)methyl]-3-(4-iodophenyl)-1,2,4-triazole (PubChem CID 107310995) has the molecular formula C15H10Cl2IN3 and a molecular weight of 430.08 g/mol. Its IUPAC name is 1-[(2,3-dichlorophenyl)methyl]-3-(4-iodophenyl)-1,2,4-triazole.
| Compound Name | 1-[(2,3-dichlorophenyl)methyl]-3-(4-iodophenyl)-1,2,4-triazole |
|---|---|
| PubChem CID | 107310995 |
| Molecular Formula | C15H10Cl2IN3 |
| Molecular Weight | 430.08 g/mol |
| Exact Mass | 428.93 |
| IUPAC Name | 1-[(2,3-dichlorophenyl)methyl]-3-(4-iodophenyl)-1,2,4-triazole |
| SMILES | Clc1cccc(Cn2cnc(-c3ccc(I)cc3)n2)c1Cl |
| InChI | InChI=1S/C15H10Cl2IN3/c16-13-3-1-2-11(14(13)17)8-21-9-19-15(20-21)10-4-6-12(18)7-5-10/h1-7,9H,8H2 |
| InChIKey | RNCNKQGCECXHIN-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.08 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|