About (3Z)-3-[(2,3-dichlorophenyl)methylidene]pyrrolidine
(3Z)-3-[(2,3-dichlorophenyl)methylidene]pyrrolidine (PubChem CID 107311001) has the molecular formula C11H11Cl2N
and a molecular weight of 228.12 g/mol. Its IUPAC name is (3Z)-3-[(2,3-dichlorophenyl)methylidene]pyrrolidine.
Molecular Properties
| Compound Name | (3Z)-3-[(2,3-dichlorophenyl)methylidene]pyrrolidine |
| PubChem CID | 107311001 |
| Molecular Formula | C11H11Cl2N |
| Molecular Weight | 228.12 g/mol |
| Exact Mass | 227.03 |
| IUPAC Name | (3Z)-3-[(2,3-dichlorophenyl)methylidene]pyrrolidine |
| SMILES | Clc1cccc(/C=C2/CCNC2)c1Cl |
| InChI | InChI=1S/C11H11Cl2N/c12-10-3-1-2-9(11(10)13)6-8-4-5-14-7-8/h1-3,6,14H,4-5,7H2/b8-6- |
| InChIKey | UCPDIGVJSMKOHD-VURMDHGXSA-N |
| XLogP | 3.37 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.12 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (3Z)-3-[(2,3-dichlorophenyl)methylidene]pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-3-[(2,3-dichlorophenyl)methylidene]pyrrolidine?
The IUPAC name of (3Z)-3-[(2,3-dichlorophenyl)methylidene]pyrrolidine (CID 107311001) is (3Z)-3-[(2,3-dichlorophenyl)methylidene]pyrrolidine.
What is the SMILES notation for (3Z)-3-[(2,3-dichlorophenyl)methylidene]pyrrolidine?
The canonical SMILES for (3Z)-3-[(2,3-dichlorophenyl)methylidene]pyrrolidine is Clc1cccc(/C=C2/CCNC2)c1Cl.
What is the InChIKey of (3Z)-3-[(2,3-dichlorophenyl)methylidene]pyrrolidine?
The InChIKey is UCPDIGVJSMKOHD-VURMDHGXSA-N. The full InChI is InChI=1S/C11H11Cl2N/c12-10-3-1-2-9(11(10)13)6-8-4-5-14-7-8/h1-3,6,14H,4-5,7H2/b8-6-.
What are the key properties of (3Z)-3-[(2,3-dichlorophenyl)methylidene]pyrrolidine?
(3Z)-3-[(2,3-dichlorophenyl)methylidene]pyrrolidine has a molecular weight of 228.12 g/mol, XLogP of 3.37, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-3-[(2,3-dichlorophenyl)methylidene]pyrrolidine is sourced from PubChem (CID 107311001), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).