C17H17Cl2NO — CID 107311478
4-(4-aminophenyl)-1-(2,3-dichlorophenyl)pentan-2-one (PubChem CID 107311478) has the molecular formula C17H17Cl2NO and a molecular weight of 322.24 g/mol. Its IUPAC name is 4-(4-aminophenyl)-1-(2,3-dichlorophenyl)pentan-2-one.
| Compound Name | 4-(4-aminophenyl)-1-(2,3-dichlorophenyl)pentan-2-one |
|---|---|
| PubChem CID | 107311478 |
| Molecular Formula | C17H17Cl2NO |
| Molecular Weight | 322.24 g/mol |
| Exact Mass | 321.07 |
| IUPAC Name | 4-(4-aminophenyl)-1-(2,3-dichlorophenyl)pentan-2-one |
| SMILES | CC(CC(=O)Cc1cccc(Cl)c1Cl)c1ccc(N)cc1 |
| InChI | InChI=1S/C17H17Cl2NO/c1-11(12-5-7-14(20)8-6-12)9-15(21)10-13-3-2-4-16(18)17(13)19/h2-8,11H,9-10,20H2,1H3 |
| InChIKey | CMBMHSWZYFTNKJ-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.24 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|