C16H23Cl2N — CID 107312312
4-cyclopentyl-1-(2,3-dichlorophenyl)-N-methylbutan-2-amine (PubChem CID 107312312) has the molecular formula C16H23Cl2N and a molecular weight of 300.27 g/mol. Its IUPAC name is 4-cyclopentyl-1-(2,3-dichlorophenyl)-N-methylbutan-2-amine.
| Compound Name | 4-cyclopentyl-1-(2,3-dichlorophenyl)-N-methylbutan-2-amine |
|---|---|
| PubChem CID | 107312312 |
| Molecular Formula | C16H23Cl2N |
| Molecular Weight | 300.27 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | 4-cyclopentyl-1-(2,3-dichlorophenyl)-N-methylbutan-2-amine |
| SMILES | CNC(CCC1CCCC1)Cc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C16H23Cl2N/c1-19-14(10-9-12-5-2-3-6-12)11-13-7-4-8-15(17)16(13)18/h4,7-8,12,14,19H,2-3,5-6,9-11H2,1H3 |
| InChIKey | BSFLDLZUURLWIJ-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.27 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |