C17H15NOS — CID 10731535
(3aR,4R)-4-phenyl-2,3,3a,4-tetrahydropyrrolo[2,1-c][1,4]benzothiazin-1-one (PubChem CID 10731535) has the molecular formula C17H15NOS and a molecular weight of 281.38 g/mol. Its IUPAC name is (3aR,4R)-4-phenyl-2,3,3a,4-tetrahydropyrrolo[2,1-c][1,4]benzothiazin-1-one.
| Compound Name | (3aR,4R)-4-phenyl-2,3,3a,4-tetrahydropyrrolo[2,1-c][1,4]benzothiazin-1-one |
|---|---|
| PubChem CID | 10731535 |
| Molecular Formula | C17H15NOS |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.09 |
| IUPAC Name | (3aR,4R)-4-phenyl-2,3,3a,4-tetrahydropyrrolo[2,1-c][1,4]benzothiazin-1-one |
| SMILES | O=C1CC[C@@H]2[C@@H](c3ccccc3)Sc3ccccc3N12 |
| InChI | InChI=1S/C17H15NOS/c19-16-11-10-14-17(12-6-2-1-3-7-12)20-15-9-5-4-8-13(15)18(14)16/h1-9,14,17H,10-11H2/t14-,17-/m1/s1 |
| InChIKey | AINFAFQBIKAVTG-RHSMWYFYSA-N |
| XLogP | 4.03 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |