C18H26O2 — CID 10731551
(2S,6S)-2-[(5,5-dideuterio-2-methyloxolan-2-yl)methyl]-6-[(2,3,4,5,6-pentadeuteriophenyl)methyl]oxane (PubChem CID 10731551) has the molecular formula C18H26O2 and a molecular weight of 281.45 g/mol. Its IUPAC name is (2S,6S)-2-[(5,5-dideuterio-2-methyloxolan-2-yl)methyl]-6-[(2,3,4,5,6-pentadeuteriophenyl)methyl]oxane.
| Compound Name | (2S,6S)-2-[(5,5-dideuterio-2-methyloxolan-2-yl)methyl]-6-[(2,3,4,5,6-pentadeuteriophenyl)methyl]oxane |
|---|---|
| PubChem CID | 10731551 |
| Molecular Formula | C18H26O2 |
| Molecular Weight | 281.45 g/mol |
| Exact Mass | 281.24 |
| IUPAC Name | (2S,6S)-2-[(5,5-dideuterio-2-methyloxolan-2-yl)methyl]-6-[(2,3,4,5,6-pentadeuteriophenyl)methyl]oxane |
| SMILES | [2H]c1c([2H])c([2H])c(C[C@@H]2CCC[C@@H](CC3(C)CCC([2H])([2H])O3)O2)c([2H])c1[2H] |
| InChI | InChI=1S/C18H26O2/c1-18(11-6-12-19-18)14-17-10-5-9-16(20-17)13-15-7-3-2-4-8-15/h2-4,7-8,16-17H,5-6,9-14H2,1H3/t16-,17-,18?/m0/s1/i2D,3D,4D,7D,8D,12D2 |
| InChIKey | KOZSBHZZGOCHSE-PRAVEIPKSA-N |
| XLogP | 4.13 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.45 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |