About [(3R,4S)-4-(4-chlorophenyl)-1-methylpiperidin-3-yl]methyl acetate
[(3R,4S)-4-(4-chlorophenyl)-1-methylpiperidin-3-yl]methyl acetate (PubChem CID 10731560) has the molecular formula C15H20ClNO2
and a molecular weight of 281.78 g/mol. Its IUPAC name is [(3R,4S)-4-(4-chlorophenyl)-1-methylpiperidin-3-yl]methyl acetate.
Molecular Properties
| Compound Name | [(3R,4S)-4-(4-chlorophenyl)-1-methylpiperidin-3-yl]methyl acetate |
| PubChem CID | 10731560 |
| Molecular Formula | C15H20ClNO2 |
| Molecular Weight | 281.78 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | [(3R,4S)-4-(4-chlorophenyl)-1-methylpiperidin-3-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1CN(C)CC[C@@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H20ClNO2/c1-11(18)19-10-13-9-17(2)8-7-15(13)12-3-5-14(16)6-4-12/h3-6,13,15H,7-10H2,1-2H3/t13-,15-/m1/s1 |
| InChIKey | HJKKWIJTYBPLCJ-UKRRQHHQSA-N |
| XLogP | 2.94 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.78 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(3R,4S)-4-(4-chlorophenyl)-1-methylpiperidin-3-yl]methyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R,4S)-4-(4-chlorophenyl)-1-methylpiperidin-3-yl]methyl acetate?
The IUPAC name of [(3R,4S)-4-(4-chlorophenyl)-1-methylpiperidin-3-yl]methyl acetate (CID 10731560) is [(3R,4S)-4-(4-chlorophenyl)-1-methylpiperidin-3-yl]methyl acetate.
What is the SMILES notation for [(3R,4S)-4-(4-chlorophenyl)-1-methylpiperidin-3-yl]methyl acetate?
The canonical SMILES for [(3R,4S)-4-(4-chlorophenyl)-1-methylpiperidin-3-yl]methyl acetate is CC(=O)OC[C@H]1CN(C)CC[C@@H]1c1ccc(Cl)cc1.
What is the InChIKey of [(3R,4S)-4-(4-chlorophenyl)-1-methylpiperidin-3-yl]methyl acetate?
The InChIKey is HJKKWIJTYBPLCJ-UKRRQHHQSA-N. The full InChI is InChI=1S/C15H20ClNO2/c1-11(18)19-10-13-9-17(2)8-7-15(13)12-3-5-14(16)6-4-12/h3-6,13,15H,7-10H2,1-2H3/t13-,15-/m1/s1.
What are the key properties of [(3R,4S)-4-(4-chlorophenyl)-1-methylpiperidin-3-yl]methyl acetate?
[(3R,4S)-4-(4-chlorophenyl)-1-methylpiperidin-3-yl]methyl acetate has a molecular weight of 281.78 g/mol, XLogP of 2.94, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R,4S)-4-(4-chlorophenyl)-1-methylpiperidin-3-yl]methyl acetate is sourced from PubChem (CID 10731560), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).