C13H17ClN2O4S — CID 107316149
(2R)-2-(2-chlorophenyl)-2-(3-methylsulfinylpropylcarbamoylamino)acetic acid (PubChem CID 107316149) has the molecular formula C13H17ClN2O4S and a molecular weight of 332.81 g/mol. Its IUPAC name is (2R)-2-(2-chlorophenyl)-2-(3-methylsulfinylpropylcarbamoylamino)acetic acid.
| Compound Name | (2R)-2-(2-chlorophenyl)-2-(3-methylsulfinylpropylcarbamoylamino)acetic acid |
|---|---|
| PubChem CID | 107316149 |
| Molecular Formula | C13H17ClN2O4S |
| Molecular Weight | 332.81 g/mol |
| Exact Mass | 332.06 |
| IUPAC Name | (2R)-2-(2-chlorophenyl)-2-(3-methylsulfinylpropylcarbamoylamino)acetic acid |
| SMILES | CS(=O)CCCNC(=O)N[C@@H](C(=O)O)c1ccccc1Cl |
| InChI | InChI=1S/C13H17ClN2O4S/c1-21(20)8-4-7-15-13(19)16-11(12(17)18)9-5-2-3-6-10(9)14/h2-3,5-6,11H,4,7-8H2,1H3,(H,17,18)(H2,15,16,19)/t11-,21?/m1/s1 |
| InChIKey | RGKOSNJNKZDROV-ZIFPNCEFSA-N |
| XLogP | 1.53 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.81 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|