About 5-[(3,5-dimethylcyclohex-3-en-1-yl)methylamino]pentan-1-ol
5-[(3,5-dimethylcyclohex-3-en-1-yl)methylamino]pentan-1-ol (PubChem CID 107316783) has the molecular formula C14H27NO
and a molecular weight of 225.38 g/mol. Its IUPAC name is 5-[(3,5-dimethylcyclohex-3-en-1-yl)methylamino]pentan-1-ol.
Molecular Properties
| Compound Name | 5-[(3,5-dimethylcyclohex-3-en-1-yl)methylamino]pentan-1-ol |
| PubChem CID | 107316783 |
| Molecular Formula | C14H27NO |
| Molecular Weight | 225.38 g/mol |
| Exact Mass | 225.21 |
| IUPAC Name | 5-[(3,5-dimethylcyclohex-3-en-1-yl)methylamino]pentan-1-ol |
| SMILES | CC1=CC(C)CC(CNCCCCCO)C1 |
| InChI | InChI=1S/C14H27NO/c1-12-8-13(2)10-14(9-12)11-15-6-4-3-5-7-16/h8,12,14-16H,3-7,9-11H2,1-2H3 |
| InChIKey | NDMKXWWUJDSPSO-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.38 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-[(3,5-dimethylcyclohex-3-en-1-yl)methylamino]pentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(3,5-dimethylcyclohex-3-en-1-yl)methylamino]pentan-1-ol?
The IUPAC name of 5-[(3,5-dimethylcyclohex-3-en-1-yl)methylamino]pentan-1-ol (CID 107316783) is 5-[(3,5-dimethylcyclohex-3-en-1-yl)methylamino]pentan-1-ol.
What is the SMILES notation for 5-[(3,5-dimethylcyclohex-3-en-1-yl)methylamino]pentan-1-ol?
The canonical SMILES for 5-[(3,5-dimethylcyclohex-3-en-1-yl)methylamino]pentan-1-ol is CC1=CC(C)CC(CNCCCCCO)C1.
What is the InChIKey of 5-[(3,5-dimethylcyclohex-3-en-1-yl)methylamino]pentan-1-ol?
The InChIKey is NDMKXWWUJDSPSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H27NO/c1-12-8-13(2)10-14(9-12)11-15-6-4-3-5-7-16/h8,12,14-16H,3-7,9-11H2,1-2H3.
What are the key properties of 5-[(3,5-dimethylcyclohex-3-en-1-yl)methylamino]pentan-1-ol?
5-[(3,5-dimethylcyclohex-3-en-1-yl)methylamino]pentan-1-ol has a molecular weight of 225.38 g/mol, XLogP of 2.73, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(3,5-dimethylcyclohex-3-en-1-yl)methylamino]pentan-1-ol is sourced from PubChem (CID 107316783), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).