About N-[(7-phenylsulfanyl-3,4-dihydronaphthalen-2-yl)methyl]hydroxylamine
N-[(7-phenylsulfanyl-3,4-dihydronaphthalen-2-yl)methyl]hydroxylamine (PubChem CID 10731711) has the molecular formula C17H17NOS
and a molecular weight of 283.40 g/mol. Its IUPAC name is N-[(7-phenylsulfanyl-3,4-dihydronaphthalen-2-yl)methyl]hydroxylamine.
Molecular Properties
| Compound Name | N-[(7-phenylsulfanyl-3,4-dihydronaphthalen-2-yl)methyl]hydroxylamine |
| PubChem CID | 10731711 |
| Molecular Formula | C17H17NOS |
| Molecular Weight | 283.40 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | N-[(7-phenylsulfanyl-3,4-dihydronaphthalen-2-yl)methyl]hydroxylamine |
| SMILES | ONCC1=Cc2cc(Sc3ccccc3)ccc2CC1 |
| InChI | InChI=1S/C17H17NOS/c19-18-12-13-6-7-14-8-9-17(11-15(14)10-13)20-16-4-2-1-3-5-16/h1-5,8-11,18-19H,6-7,12H2 |
| InChIKey | GIUHXBMKPGMVGO-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.40 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[(7-phenylsulfanyl-3,4-dihydronaphthalen-2-yl)methyl]hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(7-phenylsulfanyl-3,4-dihydronaphthalen-2-yl)methyl]hydroxylamine?
The IUPAC name of N-[(7-phenylsulfanyl-3,4-dihydronaphthalen-2-yl)methyl]hydroxylamine (CID 10731711) is N-[(7-phenylsulfanyl-3,4-dihydronaphthalen-2-yl)methyl]hydroxylamine.
What is the SMILES notation for N-[(7-phenylsulfanyl-3,4-dihydronaphthalen-2-yl)methyl]hydroxylamine?
The canonical SMILES for N-[(7-phenylsulfanyl-3,4-dihydronaphthalen-2-yl)methyl]hydroxylamine is ONCC1=Cc2cc(Sc3ccccc3)ccc2CC1.
What is the InChIKey of N-[(7-phenylsulfanyl-3,4-dihydronaphthalen-2-yl)methyl]hydroxylamine?
The InChIKey is GIUHXBMKPGMVGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17NOS/c19-18-12-13-6-7-14-8-9-17(11-15(14)10-13)20-16-4-2-1-3-5-16/h1-5,8-11,18-19H,6-7,12H2.
What are the key properties of N-[(7-phenylsulfanyl-3,4-dihydronaphthalen-2-yl)methyl]hydroxylamine?
N-[(7-phenylsulfanyl-3,4-dihydronaphthalen-2-yl)methyl]hydroxylamine has a molecular weight of 283.40 g/mol, XLogP of 4.15, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(7-phenylsulfanyl-3,4-dihydronaphthalen-2-yl)methyl]hydroxylamine is sourced from PubChem (CID 10731711), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).