C15H22N2O2 — CID 107317575
N-(5-hydroxypentyl)-1,2,3,4-tetrahydroisoquinoline-5-carboxamide (PubChem CID 107317575) has the molecular formula C15H22N2O2 and a molecular weight of 262.35 g/mol. Its IUPAC name is N-(5-hydroxypentyl)-1,2,3,4-tetrahydroisoquinoline-5-carboxamide.
| Compound Name | N-(5-hydroxypentyl)-1,2,3,4-tetrahydroisoquinoline-5-carboxamide |
|---|---|
| PubChem CID | 107317575 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | N-(5-hydroxypentyl)-1,2,3,4-tetrahydroisoquinoline-5-carboxamide |
| SMILES | O=C(NCCCCCO)c1cccc2c1CCNC2 |
| InChI | InChI=1S/C15H22N2O2/c18-10-3-1-2-8-17-15(19)14-6-4-5-12-11-16-9-7-13(12)14/h4-6,16,18H,1-3,7-11H2,(H,17,19) |
| InChIKey | OEFLREDVXVGGDC-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|